C26H38O — CID 142281756
(3Z,7Z,11Z)-7-ethyl-2-methoxy-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene;propane (PubChem CID 142281756) has the molecular formula C26H38O and a molecular weight of 366.59 g/mol. Its IUPAC name is (3Z,7Z,11Z)-7-ethyl-2-methoxy-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene;propane.
| Compound Name | (3Z,7Z,11Z)-7-ethyl-2-methoxy-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene;propane |
|---|---|
| PubChem CID | 142281756 |
| Molecular Formula | C26H38O |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.29 |
| IUPAC Name | (3Z,7Z,11Z)-7-ethyl-2-methoxy-5,6,9,10,13-pentamethylidenepentadeca-1,3,7,11-tetraene;propane |
| SMILES | C=C(/C=C\C(=C)C(=C)/C=C(/CC)C(=C)C(=C)/C=C\C(=C)OC)CC.CCC |
| InChI | InChI=1S/C23H30O.C3H8/c1-10-17(3)12-13-18(4)20(6)16-23(11-2)22(8)19(5)14-15-21(7)24-9;1-3-2/h12-16H,3-8,10-11H2,1-2,9H3;3H2,1-2H3/b13-12-,15-14-,23-16-; |
| InChIKey | IQVGRSBCDQZRGP-UJXAZSQBSA-N |
| XLogP | 8.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|