C25H37FO — CID 89146626
(2E,4E,6E,8Z,11E,13Z)-5-ethyl-11-fluoro-4-methoxy-8-prop-2-enylidene-13-propylhexadeca-2,4,6,11,13-pentaene (PubChem CID 89146626) has the molecular formula C25H37FO and a molecular weight of 372.57 g/mol. Its IUPAC name is (2E,4E,6E,8Z,11E,13Z)-5-ethyl-11-fluoro-4-methoxy-8-prop-2-enylidene-13-propylhexadeca-2,4,6,11,13-pentaene.
| Compound Name | (2E,4E,6E,8Z,11E,13Z)-5-ethyl-11-fluoro-4-methoxy-8-prop-2-enylidene-13-propylhexadeca-2,4,6,11,13-pentaene |
|---|---|
| PubChem CID | 89146626 |
| Molecular Formula | C25H37FO |
| Molecular Weight | 372.57 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | (2E,4E,6E,8Z,11E,13Z)-5-ethyl-11-fluoro-4-methoxy-8-prop-2-enylidene-13-propylhexadeca-2,4,6,11,13-pentaene |
| SMILES | C=C/C=C(\C=C\C(CC)=C(/C=C/C)OC)CC/C(F)=C\C(=C/CC)CCC |
| InChI | InChI=1S/C25H37FO/c1-7-12-21(16-18-23(11-5)25(27-6)15-10-4)17-19-24(26)20-22(13-8-2)14-9-3/h7,10,12-13,15-16,18,20H,1,8-9,11,14,17,19H2,2-6H3/b15-10+,18-16+,21-12+,22-13-,24-20+,25-23+ |
| InChIKey | QQTVZKFVQZKNDI-BYYVGVRWSA-N |
| XLogP | 8.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.57 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|