C16H23FO — CID 91554669
6-(2-fluoro-2-methylbut-3-enoxy)-3-propan-2-ylocta-1,2,4,6-tetraene (PubChem CID 91554669) has the molecular formula C16H23FO and a molecular weight of 250.36 g/mol. Its IUPAC name is 6-(2-fluoro-2-methylbut-3-enoxy)-3-propan-2-ylocta-1,2,4,6-tetraene.
| Compound Name | 6-(2-fluoro-2-methylbut-3-enoxy)-3-propan-2-ylocta-1,2,4,6-tetraene |
|---|---|
| PubChem CID | 91554669 |
| Molecular Formula | C16H23FO |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 6-(2-fluoro-2-methylbut-3-enoxy)-3-propan-2-ylocta-1,2,4,6-tetraene |
| SMILES | C=C=C(C=CC(=CC)OCC(C)(F)C=C)C(C)C |
| InChI | InChI=1S/C16H23FO/c1-7-14(13(4)5)10-11-15(8-2)18-12-16(6,17)9-3/h8-11,13H,1,3,12H2,2,4-6H3 |
| InChIKey | DBLHGXJQHZAZMT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|