C13H21FO — CID 123433108
5-(2-fluoropropan-2-yloxy)-2,6-dimethylocta-1,3,5-triene (PubChem CID 123433108) has the molecular formula C13H21FO and a molecular weight of 212.31 g/mol. Its IUPAC name is 5-(2-fluoropropan-2-yloxy)-2,6-dimethylocta-1,3,5-triene.
| Compound Name | 5-(2-fluoropropan-2-yloxy)-2,6-dimethylocta-1,3,5-triene |
|---|---|
| PubChem CID | 123433108 |
| Molecular Formula | C13H21FO |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | 5-(2-fluoropropan-2-yloxy)-2,6-dimethylocta-1,3,5-triene |
| SMILES | C=C(C)C=CC(OC(C)(C)F)=C(C)CC |
| InChI | InChI=1S/C13H21FO/c1-7-11(4)12(9-8-10(2)3)15-13(5,6)14/h8-9H,2,7H2,1,3-6H3 |
| InChIKey | JFUHVXPMIDORPV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|