C20H23FO2 — CID 145380881
(3Z,7E,11Z)-7-fluoro-2,13-dimethoxy-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene (PubChem CID 145380881) has the molecular formula C20H23FO2 and a molecular weight of 314.40 g/mol. Its IUPAC name is (3Z,7E,11Z)-7-fluoro-2,13-dimethoxy-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene.
| Compound Name | (3Z,7E,11Z)-7-fluoro-2,13-dimethoxy-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene |
|---|---|
| PubChem CID | 145380881 |
| Molecular Formula | C20H23FO2 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (3Z,7E,11Z)-7-fluoro-2,13-dimethoxy-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C=C(/F)C(=C)C(=C)/C=C\C(=C)OC)OC |
| InChI | InChI=1S/C20H23FO2/c1-14(9-11-17(4)22-7)16(3)13-20(21)19(6)15(2)10-12-18(5)23-8/h9-13H,1-6H2,7-8H3/b11-9-,12-10-,20-13+ |
| InChIKey | WLYHPSRWVRVJSW-ZSSVHQDYSA-N |
| XLogP | 5.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|