C12H19FO — CID 123770155
5-(2-fluoropropan-2-yloxy)-2,6-dimethylhepta-1,3,5-triene (PubChem CID 123770155) has the molecular formula C12H19FO and a molecular weight of 198.28 g/mol. Its IUPAC name is 5-(2-fluoropropan-2-yloxy)-2,6-dimethylhepta-1,3,5-triene.
| Compound Name | 5-(2-fluoropropan-2-yloxy)-2,6-dimethylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 123770155 |
| Molecular Formula | C12H19FO |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 5-(2-fluoropropan-2-yloxy)-2,6-dimethylhepta-1,3,5-triene |
| SMILES | C=C(C)C=CC(OC(C)(C)F)=C(C)C |
| InChI | InChI=1S/C12H19FO/c1-9(2)7-8-11(10(3)4)14-12(5,6)13/h7-8H,1H2,2-6H3 |
| InChIKey | NZEGZSQAOYHGQC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|