C16H24O — CID 134897895
(3E,7E,11E)-4,8,12-trimethyl-2-methylidene-1-oxacyclotrideca-3,7,11-triene (PubChem CID 134897895) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is (3E,7E,11E)-4,8,12-trimethyl-2-methylidene-1-oxacyclotrideca-3,7,11-triene.
| Compound Name | (3E,7E,11E)-4,8,12-trimethyl-2-methylidene-1-oxacyclotrideca-3,7,11-triene |
|---|---|
| PubChem CID | 134897895 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | (3E,7E,11E)-4,8,12-trimethyl-2-methylidene-1-oxacyclotrideca-3,7,11-triene |
| SMILES | C=C1/C=C(\C)CC/C=C(\C)CC/C=C(\C)CO1 |
| InChI | InChI=1S/C16H24O/c1-13-7-5-9-14(2)11-16(4)17-12-15(3)10-6-8-13/h7,10-11H,4-6,8-9,12H2,1-3H3/b13-7+,14-11+,15-10+ |
| InChIKey | OGQYZDDJGNFUPF-NQJXNNKBSA-N |
| XLogP | 4.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|