C24H38O3 — CID 145122176
ethane;(3Z,7Z)-7-ethyl-2-methoxy-3-(2-methoxyethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene;prop-2-enal (PubChem CID 145122176) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is ethane;(3Z,7Z)-7-ethyl-2-methoxy-3-(2-methoxyethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene;prop-2-enal.
| Compound Name | ethane;(3Z,7Z)-7-ethyl-2-methoxy-3-(2-methoxyethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene;prop-2-enal |
|---|---|
| PubChem CID | 145122176 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | ethane;(3Z,7Z)-7-ethyl-2-methoxy-3-(2-methoxyethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene;prop-2-enal |
| SMILES | C=C(C)/C=C(/CC)C(=C)C(=C)/C=C(\CCOC)C(=C)OC.C=CC=O.CC |
| InChI | InChI=1S/C19H28O2.C3H4O.C2H6/c1-9-18(12-14(2)3)16(5)15(4)13-19(10-11-20-7)17(6)21-8;1-2-3-4;1-2/h12-13H,2,4-6,9-11H2,1,3,7-8H3;2-3H,1H2;1-2H3/b18-12-,19-13-;; |
| InChIKey | ZKTWVEOKUUCXKZ-WGNCTNBJSA-N |
| XLogP | 6.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|