C22H34O3 — CID 145122161
formaldehyde;(3Z,7Z)-2-methoxy-3-(2-methoxyethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene;2-methylprop-1-ene (PubChem CID 145122161) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is formaldehyde;(3Z,7Z)-2-methoxy-3-(2-methoxyethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene;2-methylprop-1-ene.
| Compound Name | formaldehyde;(3Z,7Z)-2-methoxy-3-(2-methoxyethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene;2-methylprop-1-ene |
|---|---|
| PubChem CID | 145122161 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | formaldehyde;(3Z,7Z)-2-methoxy-3-(2-methoxyethyl)-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene;2-methylprop-1-ene |
| SMILES | C=C(C)/C=C\C(=C)C(=C)/C=C(\CCOC)C(=C)OC.C=C(C)C.C=O |
| InChI | InChI=1S/C17H24O2.C4H8.CH2O/c1-13(2)8-9-14(3)15(4)12-17(10-11-18-6)16(5)19-7;1-4(2)3;1-2/h8-9,12H,1,3-5,10-11H2,2,6-7H3;1H2,2-3H3;1H2/b9-8-,17-12-;; |
| InChIKey | UMNOAFWZOLLSSZ-PXFCSZOSSA-N |
| XLogP | 5.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|