C16H22O4 — CID 139498398
(3E,5E,7Z)-2,4,9-trimethoxy-5-(methoxymethylidene)-6-methylidenedeca-1,3,7,9-tetraene (PubChem CID 139498398) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (3E,5E,7Z)-2,4,9-trimethoxy-5-(methoxymethylidene)-6-methylidenedeca-1,3,7,9-tetraene.
| Compound Name | (3E,5E,7Z)-2,4,9-trimethoxy-5-(methoxymethylidene)-6-methylidenedeca-1,3,7,9-tetraene |
|---|---|
| PubChem CID | 139498398 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (3E,5E,7Z)-2,4,9-trimethoxy-5-(methoxymethylidene)-6-methylidenedeca-1,3,7,9-tetraene |
| SMILES | C=C(/C=C\C(=C)C(=COC)/C(=C\C(=C)OC)OC)OC |
| InChI | InChI=1S/C16H22O4/c1-12(8-9-13(2)18-5)15(11-17-4)16(20-7)10-14(3)19-6/h8-11H,1-3H2,4-7H3/b9-8-,15-11+,16-10+ |
| InChIKey | NFYYDRJTVJAYMR-LQEQFJCZSA-N |
| XLogP | 3.48 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|