C18H16O2 — CID 6536678
(1Z,7Z,9Z,11Z)-3,16-dimethoxytricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 6536678) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is (1Z,7Z,9Z,11Z)-3,16-dimethoxytricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | (1Z,7Z,9Z,11Z)-3,16-dimethoxytricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 6536678 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (1Z,7Z,9Z,11Z)-3,16-dimethoxytricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | COc1cccc2/c1=c1/c(OC)ccc/c1=C/C=C\C=2 |
| InChI | InChI=1S/C18H16O2/c1-19-15-11-5-9-13-7-3-4-8-14-10-6-12-16(20-2)18(14)17(13)15/h3-12H,1-2H3/b4-3-,7-3-,8-4-,13-7-,14-8-,18-17- |
| InChIKey | NUTLXEPVSUDTLD-TVEGTSRISA-N |
| XLogP | 2.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |