C18H14Br2O2 — CID 11304739
(1Z,7Z,9Z,11Z)-9,10-dibromo-3,16-dimethoxytricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 11304739) has the molecular formula C18H14Br2O2 and a molecular weight of 422.12 g/mol. Its IUPAC name is (1Z,7Z,9Z,11Z)-9,10-dibromo-3,16-dimethoxytricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | (1Z,7Z,9Z,11Z)-9,10-dibromo-3,16-dimethoxytricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 11304739 |
| Molecular Formula | C18H14Br2O2 |
| Molecular Weight | 422.12 g/mol |
| Exact Mass | 419.94 |
| IUPAC Name | (1Z,7Z,9Z,11Z)-9,10-dibromo-3,16-dimethoxytricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | COc1cccc2/c1=c1/c(OC)ccc/c1=C/C(Br)=C(Br)\C=2 |
| InChI | InChI=1S/C18H14Br2O2/c1-21-15-7-3-5-11-9-13(19)14(20)10-12-6-4-8-16(22-2)18(12)17(11)15/h3-10H,1-2H3/b11-9-,12-10-,13-9+,14-10+,14-13-,18-17- |
| InChIKey | CKXAAYMGCIEVOH-BHDMITAHSA-N |
| XLogP | 3.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.12 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |