C15H21BrO — CID 143422302
(5E)-1-bromo-4-methoxy-6-methylidene-5-[(Z)-pent-3-enylidene]cyclohexa-1,3-diene;ethane (PubChem CID 143422302) has the molecular formula C15H21BrO and a molecular weight of 297.24 g/mol. Its IUPAC name is (5E)-1-bromo-4-methoxy-6-methylidene-5-[(Z)-pent-3-enylidene]cyclohexa-1,3-diene;ethane.
| Compound Name | (5E)-1-bromo-4-methoxy-6-methylidene-5-[(Z)-pent-3-enylidene]cyclohexa-1,3-diene;ethane |
|---|---|
| PubChem CID | 143422302 |
| Molecular Formula | C15H21BrO |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | (5E)-1-bromo-4-methoxy-6-methylidene-5-[(Z)-pent-3-enylidene]cyclohexa-1,3-diene;ethane |
| SMILES | C=c1c(Br)ccc(OC)/c1=C/C/C=C\C.CC |
| InChI | InChI=1S/C13H15BrO.C2H6/c1-4-5-6-7-11-10(2)12(14)8-9-13(11)15-3;1-2/h4-5,7-9H,2,6H2,1,3H3;1-2H3/b5-4-,11-7+; |
| InChIKey | OQJRCVTWGQROPC-YAEMQSPGSA-N |
| XLogP | 3.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|