C9H10BrOY- — CID 58089075
1-bromo-2-methoxy-3,5-dimethylbenzene-4-ide;yttrium (PubChem CID 58089075) has the molecular formula C9H10BrOY- and a molecular weight of 302.99 g/mol. Its IUPAC name is 1-bromo-2-methoxy-3,5-dimethylbenzene-4-ide;yttrium.
| Compound Name | 1-bromo-2-methoxy-3,5-dimethylbenzene-4-ide;yttrium |
|---|---|
| PubChem CID | 58089075 |
| Molecular Formula | C9H10BrOY- |
| Molecular Weight | 302.99 g/mol |
| Exact Mass | 301.90 |
| IUPAC Name | 1-bromo-2-methoxy-3,5-dimethylbenzene-4-ide;yttrium |
| SMILES | COc1c(C)[c-]c(C)cc1Br.[Y] |
| InChI | InChI=1S/C9H10BrO.Y/c1-6-4-7(2)9(11-3)8(10)5-6;/h5H,1-3H3;/q-1; |
| InChIKey | UEEXGUPOXLCVDC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.99 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|