About 5-bromo-4-methoxy-1,2-dimethylcyclohepta-1,3,5-triene
5-bromo-4-methoxy-1,2-dimethylcyclohepta-1,3,5-triene (PubChem CID 134865189) has the molecular formula C10H13BrO
and a molecular weight of 229.12 g/mol. Its IUPAC name is 5-bromo-4-methoxy-1,2-dimethylcyclohepta-1,3,5-triene.
Analyze 5-bromo-4-methoxy-1,2-dimethylcyclohepta-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-4-methoxy-1,2-dimethylcyclohepta-1,3,5-triene?
The IUPAC name of 5-bromo-4-methoxy-1,2-dimethylcyclohepta-1,3,5-triene (CID 134865189) is 5-bromo-4-methoxy-1,2-dimethylcyclohepta-1,3,5-triene.
What is the SMILES notation for 5-bromo-4-methoxy-1,2-dimethylcyclohepta-1,3,5-triene?
The canonical SMILES for 5-bromo-4-methoxy-1,2-dimethylcyclohepta-1,3,5-triene is COC1=CC(C)=C(C)CC=C1Br.
What is the InChIKey of 5-bromo-4-methoxy-1,2-dimethylcyclohepta-1,3,5-triene?
The InChIKey is XNXAZSQSGVFAII-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrO/c1-7-4-5-9(11)10(12-3)6-8(7)2/h5-6H,4H2,1-3H3.
What are the key properties of 5-bromo-4-methoxy-1,2-dimethylcyclohepta-1,3,5-triene?
5-bromo-4-methoxy-1,2-dimethylcyclohepta-1,3,5-triene has a molecular weight of 229.12 g/mol, XLogP of 3.54, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-4-methoxy-1,2-dimethylcyclohepta-1,3,5-triene is sourced from PubChem (CID 134865189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).