C26H18Br2O2 — CID 141477194
(4aZ,8aZ,12aZ,16aZ)-1,16-dibromo-8,9-dimethoxytetraphenylene (PubChem CID 141477194) has the molecular formula C26H18Br2O2 and a molecular weight of 522.24 g/mol. Its IUPAC name is (4aZ,8aZ,12aZ,16aZ)-1,16-dibromo-8,9-dimethoxytetraphenylene.
| Compound Name | (4aZ,8aZ,12aZ,16aZ)-1,16-dibromo-8,9-dimethoxytetraphenylene |
|---|---|
| PubChem CID | 141477194 |
| Molecular Formula | C26H18Br2O2 |
| Molecular Weight | 522.24 g/mol |
| Exact Mass | 519.97 |
| IUPAC Name | (4aZ,8aZ,12aZ,16aZ)-1,16-dibromo-8,9-dimethoxytetraphenylene |
| SMILES | COc1cccc2/c1=c1/c(OC)ccc/c1=c1\cccc(Br)\c1=c1/c(Br)ccc/c1=2 |
| InChI | InChI=1S/C26H18Br2O2/c1-29-21-13-5-9-17-15-7-3-11-19(27)23(15)24-16(8-4-12-20(24)28)18-10-6-14-22(30-2)26(18)25(17)21/h3-14H,1-2H3/b17-15-,18-16-,24-23-,26-25- |
| InChIKey | KHOCFLIZDRGBDM-XRHSMZPWSA-N |
| XLogP | 6.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.24 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |