C28H24O4 — CID 135016964
(4aZ,8aE,12aZ,16aE)-1,4,5,9-tetramethoxytetraphenylene (PubChem CID 135016964) has the molecular formula C28H24O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is (4aZ,8aE,12aZ,16aE)-1,4,5,9-tetramethoxytetraphenylene.
| Compound Name | (4aZ,8aE,12aZ,16aE)-1,4,5,9-tetramethoxytetraphenylene |
|---|---|
| PubChem CID | 135016964 |
| Molecular Formula | C28H24O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (4aZ,8aE,12aZ,16aE)-1,4,5,9-tetramethoxytetraphenylene |
| SMILES | COc1cccc2/c1=c1/c(OC)ccc(OC)/c1=c1\cccc\c1=c1/cccc(OC)/c1=2 |
| InChI | InChI=1S/C28H24O4/c1-29-21-13-7-11-18-17-9-5-6-10-19(17)26-23(31-3)15-16-24(32-4)28(26)27-20(25(18)21)12-8-14-22(27)30-2/h5-16H,1-4H3/b18-17-,25-20+,26-19-,28-27+ |
| InChIKey | MJOVVGBSXUFWBT-WBOMRGJJSA-N |
| XLogP | 5.18 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |