C30H28O6 — CID 135016708
(4aZ,8aZ,12aZ,16aZ)-1,4,5,8,9,16-hexamethoxytetraphenylene (PubChem CID 135016708) has the molecular formula C30H28O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is (4aZ,8aZ,12aZ,16aZ)-1,4,5,8,9,16-hexamethoxytetraphenylene.
| Compound Name | (4aZ,8aZ,12aZ,16aZ)-1,4,5,8,9,16-hexamethoxytetraphenylene |
|---|---|
| PubChem CID | 135016708 |
| Molecular Formula | C30H28O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | (4aZ,8aZ,12aZ,16aZ)-1,4,5,8,9,16-hexamethoxytetraphenylene |
| SMILES | COc1cccc2/c1=c1/c(OC)ccc(OC)/c1=c1\c(OC)ccc(OC)\c1=c1/c(OC)ccc/c1=2 |
| InChI | InChI=1S/C30H28O6/c1-31-19-11-7-9-17-18-10-8-12-20(32-2)26(18)28-22(34-4)14-16-24(36-6)30(28)29-23(35-5)15-13-21(33-3)27(29)25(17)19/h7-16H,1-6H3/b18-17-,27-25+,28-26+,30-29- |
| InChIKey | DSGHKGRWUWSJEC-QDIPRLHDSA-N |
| XLogP | 5.20 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |