C26H20O2 — CID 11257041
(4aZ,8aZ,12aZ,16aZ)-1,16-dimethoxytetraphenylene (PubChem CID 11257041) has the molecular formula C26H20O2 and a molecular weight of 364.44 g/mol. Its IUPAC name is (4aZ,8aZ,12aZ,16aZ)-1,16-dimethoxytetraphenylene.
| Compound Name | (4aZ,8aZ,12aZ,16aZ)-1,16-dimethoxytetraphenylene |
|---|---|
| PubChem CID | 11257041 |
| Molecular Formula | C26H20O2 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (4aZ,8aZ,12aZ,16aZ)-1,16-dimethoxytetraphenylene |
| SMILES | COc1cccc2/c1=c1/c(OC)ccc/c1=c1\cccc\c1=c1/cccc/c1=2 |
| InChI | InChI=1S/C26H20O2/c1-27-23-15-7-13-21-19-11-5-3-9-17(19)18-10-4-6-12-20(18)22-14-8-16-24(28-2)26(22)25(21)23/h3-16H,1-2H3/b18-17-,21-19-,22-20-,26-25- |
| InChIKey | RFBFZADPJBFYMN-LPSZOVBGSA-N |
| XLogP | 5.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |