C16H12O2 — CID 123929196
1,8-dihydrochromeno[4,3-b]chromene (PubChem CID 123929196) has the molecular formula C16H12O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 1,8-dihydrochromeno[4,3-b]chromene.
| Compound Name | 1,8-dihydrochromeno[4,3-b]chromene |
|---|---|
| PubChem CID | 123929196 |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1,8-dihydrochromeno[4,3-b]chromene |
| SMILES | C1=CCC2=CC3=COC4=CC=CCC4=C3OC2=C1 |
| InChI | InChI=1S/C16H12O2/c1-3-7-14-11(5-1)9-12-10-17-15-8-4-2-6-13(15)16(12)18-14/h1-4,7-10H,5-6H2 |
| InChIKey | YRJZRCNNDOJHDP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |