C24H28O2 — CID 12626728
(1Z,7E,9E,11Z)-8,10-bis[(2-methylpropan-2-yl)oxy]tricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene (PubChem CID 12626728) has the molecular formula C24H28O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is (1Z,7E,9E,11Z)-8,10-bis[(2-methylpropan-2-yl)oxy]tricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene.
| Compound Name | (1Z,7E,9E,11Z)-8,10-bis[(2-methylpropan-2-yl)oxy]tricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene |
|---|---|
| PubChem CID | 12626728 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | (1Z,7E,9E,11Z)-8,10-bis[(2-methylpropan-2-yl)oxy]tricyclo[10.4.0.02,7]hexadeca-1,3,5,7,9,11,13,15-octaene |
| SMILES | CC(C)(C)OC1=C/C(OC(C)(C)C)=c2/cccc/c2=c2\cccc\c2=C\1 |
| InChI | InChI=1S/C24H28O2/c1-23(2,3)25-18-15-17-11-7-8-12-19(17)20-13-9-10-14-21(20)22(16-18)26-24(4,5)6/h7-16H,1-6H3/b17-15-,18-15+,18-16+,20-19-,22-16+,22-21+ |
| InChIKey | FRMPUWLNRGUMOC-QWBVLHKPSA-N |
| XLogP | 4.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |