C14H12O2 — CID 11287311
2,7-dimethoxybiphenylene (PubChem CID 11287311) has the molecular formula C14H12O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2,7-dimethoxybiphenylene.
| Compound Name | 2,7-dimethoxybiphenylene |
|---|---|
| PubChem CID | 11287311 |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2,7-dimethoxybiphenylene |
| SMILES | COc1ccc2c(c1)=c1cc(OC)ccc1=2 |
| InChI | InChI=1S/C14H12O2/c1-15-9-3-5-11-12-6-4-10(16-2)8-14(12)13(11)7-9/h3-8H,1-2H3 |
| InChIKey | MGFUVMFFFFKZHD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |