C14H10F2O — CID 139776697
3-ethoxy-1,8-difluorobiphenylene (PubChem CID 139776697) has the molecular formula C14H10F2O and a molecular weight of 232.23 g/mol. Its IUPAC name is 3-ethoxy-1,8-difluorobiphenylene.
| Compound Name | 3-ethoxy-1,8-difluorobiphenylene |
|---|---|
| PubChem CID | 139776697 |
| Molecular Formula | C14H10F2O |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 3-ethoxy-1,8-difluorobiphenylene |
| SMILES | CCOc1cc(F)c2c(c1)=c1cccc(F)c1=2 |
| InChI | InChI=1S/C14H10F2O/c1-2-17-8-6-10-9-4-3-5-11(15)13(9)14(10)12(16)7-8/h3-7H,2H2,1H3 |
| InChIKey | XYXFILPHUOITMD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |