C13H15BrO — CID 143422303
(5E)-1-bromo-4-methoxy-6-methylidene-5-[(Z)-pent-3-enylidene]cyclohexa-1,3-diene (PubChem CID 143422303) has the molecular formula C13H15BrO and a molecular weight of 267.17 g/mol. Its IUPAC name is (5E)-1-bromo-4-methoxy-6-methylidene-5-[(Z)-pent-3-enylidene]cyclohexa-1,3-diene.
| Compound Name | (5E)-1-bromo-4-methoxy-6-methylidene-5-[(Z)-pent-3-enylidene]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143422303 |
| Molecular Formula | C13H15BrO |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | (5E)-1-bromo-4-methoxy-6-methylidene-5-[(Z)-pent-3-enylidene]cyclohexa-1,3-diene |
| SMILES | C=c1c(Br)ccc(OC)/c1=C/C/C=C\C |
| InChI | InChI=1S/C13H15BrO/c1-4-5-6-7-11-10(2)12(14)8-9-13(11)15-3/h4-5,7-9H,2,6H2,1,3H3/b5-4-,11-7+ |
| InChIKey | VLQKOEUOANTYMP-DNFZQOLXSA-N |
| XLogP | 2.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|