C23H28F2O2 — CID 145122720
(3Z,7Z,11Z)-7,8-difluoro-2-methoxy-3-(2-methoxyethyl)-13-methyl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene (PubChem CID 145122720) has the molecular formula C23H28F2O2 and a molecular weight of 374.47 g/mol. Its IUPAC name is (3Z,7Z,11Z)-7,8-difluoro-2-methoxy-3-(2-methoxyethyl)-13-methyl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene.
| Compound Name | (3Z,7Z,11Z)-7,8-difluoro-2-methoxy-3-(2-methoxyethyl)-13-methyl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene |
|---|---|
| PubChem CID | 145122720 |
| Molecular Formula | C23H28F2O2 |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (3Z,7Z,11Z)-7,8-difluoro-2-methoxy-3-(2-methoxyethyl)-13-methyl-5,6,9,10-tetramethylidenetetradeca-1,3,7,11,13-pentaene |
| SMILES | C=C(C)/C=C\C(=C)C(=C)/C(F)=C(/F)C(=C)C(=C)/C=C(/CCOC)C(=C)OC |
| InChI | InChI=1S/C23H28F2O2/c1-15(2)10-11-16(3)18(5)22(24)23(25)19(6)17(4)14-21(12-13-26-8)20(7)27-9/h10-11,14H,1,3-7,12-13H2,2,8-9H3/b11-10-,21-14-,23-22- |
| InChIKey | YHFULSSWYMGDOG-RDTLDRIKSA-N |
| XLogP | 6.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|