C14H16F2O — CID 142297509
(3Z,7Z)-3,4-difluoro-2-methoxy-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene (PubChem CID 142297509) has the molecular formula C14H16F2O and a molecular weight of 238.28 g/mol. Its IUPAC name is (3Z,7Z)-3,4-difluoro-2-methoxy-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene.
| Compound Name | (3Z,7Z)-3,4-difluoro-2-methoxy-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene |
|---|---|
| PubChem CID | 142297509 |
| Molecular Formula | C14H16F2O |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (3Z,7Z)-3,4-difluoro-2-methoxy-9-methyl-5,6-dimethylidenedeca-1,3,7,9-tetraene |
| SMILES | C=C(C)/C=C\C(=C)C(=C)/C(F)=C(/F)C(=C)OC |
| InChI | InChI=1S/C14H16F2O/c1-9(2)7-8-10(3)11(4)13(15)14(16)12(5)17-6/h7-8H,1,3-5H2,2,6H3/b8-7-,14-13- |
| InChIKey | WSLQNSOISQFCBF-WRKWTSPFSA-N |
| XLogP | 4.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|