C21H32O2 — CID 123327845
5-ethoxy-6-methyl-3-[1-(3-methylocta-3,5,7-trien-4-yloxy)ethyl]hepta-1,3,5-triene (PubChem CID 123327845) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is 5-ethoxy-6-methyl-3-[1-(3-methylocta-3,5,7-trien-4-yloxy)ethyl]hepta-1,3,5-triene.
| Compound Name | 5-ethoxy-6-methyl-3-[1-(3-methylocta-3,5,7-trien-4-yloxy)ethyl]hepta-1,3,5-triene |
|---|---|
| PubChem CID | 123327845 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 5-ethoxy-6-methyl-3-[1-(3-methylocta-3,5,7-trien-4-yloxy)ethyl]hepta-1,3,5-triene |
| SMILES | C=CC=CC(OC(C)C(C=C)=CC(OCC)=C(C)C)=C(C)CC |
| InChI | InChI=1S/C21H32O2/c1-9-13-14-20(17(7)10-2)23-18(8)19(11-3)15-21(16(5)6)22-12-4/h9,11,13-15,18H,1,3,10,12H2,2,4-8H3 |
| InChIKey | SUDWVPSSXHOPOX-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|