C30H37F3O2 — CID 143772466
(3Z,7Z,11E,14E)-3,4,11-trifluoro-14-methyl-5,6,9,10,13-pentamethylidene-2-[(Z)-prop-1-enoxy]-17-propoxyoctadeca-1,3,7,11,14-pentaene (PubChem CID 143772466) has the molecular formula C30H37F3O2 and a molecular weight of 486.62 g/mol. Its IUPAC name is (3Z,7Z,11E,14E)-3,4,11-trifluoro-14-methyl-5,6,9,10,13-pentamethylidene-2-[(Z)-prop-1-enoxy]-17-propoxyoctadeca-1,3,7,11,14-pentaene.
| Compound Name | (3Z,7Z,11E,14E)-3,4,11-trifluoro-14-methyl-5,6,9,10,13-pentamethylidene-2-[(Z)-prop-1-enoxy]-17-propoxyoctadeca-1,3,7,11,14-pentaene |
|---|---|
| PubChem CID | 143772466 |
| Molecular Formula | C30H37F3O2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | (3Z,7Z,11E,14E)-3,4,11-trifluoro-14-methyl-5,6,9,10,13-pentamethylidene-2-[(Z)-prop-1-enoxy]-17-propoxyoctadeca-1,3,7,11,14-pentaene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(F)=C(\F)C(=C)O/C=C\C)C(=C)/C(F)=C\C(=C)/C(C)=C/CC(C)OCCC |
| InChI | InChI=1S/C30H37F3O2/c1-11-17-34-24(7)16-15-20(3)23(6)19-28(31)25(8)21(4)13-14-22(5)26(9)29(32)30(33)27(10)35-18-12-2/h12-15,18-19,24H,4-6,8-11,16-17H2,1-3,7H3/b14-13-,18-12-,20-15+,28-19+,30-29- |
| InChIKey | CZFPOCFGONGYAK-LMWMZJHESA-N |
| XLogP | 9.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|