C19H26O2 — CID 123885789
6-[2-methoxy-4-(methoxymethyl)-3-methylideneocta-1,4,6-trienyl]-2-methylcyclohexa-1,3-diene (PubChem CID 123885789) has the molecular formula C19H26O2 and a molecular weight of 286.41 g/mol. Its IUPAC name is 6-[2-methoxy-4-(methoxymethyl)-3-methylideneocta-1,4,6-trienyl]-2-methylcyclohexa-1,3-diene.
| Compound Name | 6-[2-methoxy-4-(methoxymethyl)-3-methylideneocta-1,4,6-trienyl]-2-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 123885789 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 6-[2-methoxy-4-(methoxymethyl)-3-methylideneocta-1,4,6-trienyl]-2-methylcyclohexa-1,3-diene |
| SMILES | C=C(C(=CC=CC)COC)C(=CC1C=C(C)C=CC1)OC |
| InChI | InChI=1S/C19H26O2/c1-6-7-11-18(14-20-4)16(3)19(21-5)13-17-10-8-9-15(2)12-17/h6-9,11-13,17H,3,10,14H2,1-2,4-5H3 |
| InChIKey | NVMRKNXYJRGZPM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|