C24H33FO3 — CID 145122857
[(3Z,7E,11Z)-8-fluoro-3-(1-methoxyethenyl)-10,13-dimethyl-5,6,9-trimethylidenepentadeca-3,7,11-trienyl] formate (PubChem CID 145122857) has the molecular formula C24H33FO3 and a molecular weight of 388.52 g/mol. Its IUPAC name is [(3Z,7E,11Z)-8-fluoro-3-(1-methoxyethenyl)-10,13-dimethyl-5,6,9-trimethylidenepentadeca-3,7,11-trienyl] formate.
| Compound Name | [(3Z,7E,11Z)-8-fluoro-3-(1-methoxyethenyl)-10,13-dimethyl-5,6,9-trimethylidenepentadeca-3,7,11-trienyl] formate |
|---|---|
| PubChem CID | 145122857 |
| Molecular Formula | C24H33FO3 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | [(3Z,7E,11Z)-8-fluoro-3-(1-methoxyethenyl)-10,13-dimethyl-5,6,9-trimethylidenepentadeca-3,7,11-trienyl] formate |
| SMILES | C=C(/C=C(/CCOC=O)C(=C)OC)C(=C)/C=C(/F)C(=C)C(C)/C=C\C(C)CC |
| InChI | InChI=1S/C24H33FO3/c1-9-17(2)10-11-18(3)21(6)24(25)15-20(5)19(4)14-23(22(7)27-8)12-13-28-16-26/h10-11,14-18H,4-7,9,12-13H2,1-3,8H3/b11-10-,23-14-,24-15+ |
| InChIKey | BNERCMHHEXGJDW-YBMUUUSHSA-N |
| XLogP | 6.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|