C21H32O3 — CID 145122592
ethane;[(2E,5Z)-2-(2-methoxyprop-2-enylidene)-7-methyl-3,4-dimethylideneocta-5,7-dienyl] formate;prop-1-ene (PubChem CID 145122592) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is ethane;[(2E,5Z)-2-(2-methoxyprop-2-enylidene)-7-methyl-3,4-dimethylideneocta-5,7-dienyl] formate;prop-1-ene.
| Compound Name | ethane;[(2E,5Z)-2-(2-methoxyprop-2-enylidene)-7-methyl-3,4-dimethylideneocta-5,7-dienyl] formate;prop-1-ene |
|---|---|
| PubChem CID | 145122592 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | ethane;[(2E,5Z)-2-(2-methoxyprop-2-enylidene)-7-methyl-3,4-dimethylideneocta-5,7-dienyl] formate;prop-1-ene |
| SMILES | C=C(C)/C=C\C(=C)C(=C)/C(=C\C(=C)OC)COC=O.C=CC.CC |
| InChI | InChI=1S/C16H20O3.C3H6.C2H6/c1-12(2)7-8-13(3)15(5)16(10-19-11-17)9-14(4)18-6;1-3-2;1-2/h7-9,11H,1,3-5,10H2,2,6H3;3H,1H2,2H3;1-2H3/b8-7-,16-9-;; |
| InChIKey | HETKIBXDJBPOKS-CVXSJGSXSA-N |
| XLogP | 5.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|