C23H33FO2 — CID 145122182
(3E,7E,11Z)-7-fluoro-2-methoxy-4-(methoxymethyl)-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraene (PubChem CID 145122182) has the molecular formula C23H33FO2 and a molecular weight of 360.51 g/mol. Its IUPAC name is (3E,7E,11Z)-7-fluoro-2-methoxy-4-(methoxymethyl)-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraene.
| Compound Name | (3E,7E,11Z)-7-fluoro-2-methoxy-4-(methoxymethyl)-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 145122182 |
| Molecular Formula | C23H33FO2 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | (3E,7E,11Z)-7-fluoro-2-methoxy-4-(methoxymethyl)-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraene |
| SMILES | C=C(/C=C(/COC)C(=C)C(=C)/C(F)=C\C(=C)C(C)/C=C\C(C)CC)OC |
| InChI | InChI=1S/C23H33FO2/c1-10-16(2)11-12-17(3)18(4)13-23(24)21(7)20(6)22(15-25-8)14-19(5)26-9/h11-14,16-17H,4-7,10,15H2,1-3,8-9H3/b12-11-,22-14-,23-13+ |
| InChIKey | DPABSKZCQAJLMA-LIAIHIOJSA-N |
| XLogP | 6.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|