C29H37F3O — CID 143772468
(3Z,7Z,11E,14E)-2-butoxy-3,4,11-trifluoro-14,17-dimethyl-5,6,9,10,13-pentamethylideneoctadeca-1,3,7,11,14-pentaene (PubChem CID 143772468) has the molecular formula C29H37F3O and a molecular weight of 458.61 g/mol. Its IUPAC name is (3Z,7Z,11E,14E)-2-butoxy-3,4,11-trifluoro-14,17-dimethyl-5,6,9,10,13-pentamethylideneoctadeca-1,3,7,11,14-pentaene.
| Compound Name | (3Z,7Z,11E,14E)-2-butoxy-3,4,11-trifluoro-14,17-dimethyl-5,6,9,10,13-pentamethylideneoctadeca-1,3,7,11,14-pentaene |
|---|---|
| PubChem CID | 143772468 |
| Molecular Formula | C29H37F3O |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | (3Z,7Z,11E,14E)-2-butoxy-3,4,11-trifluoro-14,17-dimethyl-5,6,9,10,13-pentamethylideneoctadeca-1,3,7,11,14-pentaene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(F)=C(/F)C(=C)OCCCC)C(=C)/C(F)=C/C(=C)/C(C)=C/CC(C)C |
| InChI | InChI=1S/C29H37F3O/c1-11-12-17-33-26(10)29(32)28(31)25(9)22(6)16-15-21(5)24(8)27(30)18-23(7)20(4)14-13-19(2)3/h14-16,18-19H,5-13,17H2,1-4H3/b16-15-,20-14+,27-18+,29-28- |
| InChIKey | WRTYMSPSRIELIU-NXHMSKHHSA-N |
| XLogP | 9.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|