C19H24F2O — CID 134375165
7-[(3Z,5E)-5-ethoxy-3,4-difluorohepta-1,3,5-trien-2-yl]-3-propylcyclohepta-1,3,5-triene (PubChem CID 134375165) has the molecular formula C19H24F2O and a molecular weight of 306.40 g/mol. Its IUPAC name is 7-[(3Z,5E)-5-ethoxy-3,4-difluorohepta-1,3,5-trien-2-yl]-3-propylcyclohepta-1,3,5-triene.
| Compound Name | 7-[(3Z,5E)-5-ethoxy-3,4-difluorohepta-1,3,5-trien-2-yl]-3-propylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 134375165 |
| Molecular Formula | C19H24F2O |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 7-[(3Z,5E)-5-ethoxy-3,4-difluorohepta-1,3,5-trien-2-yl]-3-propylcyclohepta-1,3,5-triene |
| SMILES | C=C(/C(F)=C(F)\C(=C/C)OCC)C1C=CC=C(CCC)C=C1 |
| InChI | InChI=1S/C19H24F2O/c1-5-9-15-10-8-11-16(13-12-15)14(4)18(20)19(21)17(6-2)22-7-3/h6,8,10-13,16H,4-5,7,9H2,1-3H3/b17-6+,19-18- |
| InChIKey | GXSMPJOSYMVRCO-HAEQQCBBSA-N |
| XLogP | 6.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|