C20H30 — CID 142246043
acetylene;ethane;7-methyl-3-[(3Z,5Z)-5-methylhepta-3,5-dienyl]cyclohepta-1,3,5-triene (PubChem CID 142246043) has the molecular formula C20H30 and a molecular weight of 270.46 g/mol. Its IUPAC name is acetylene;ethane;7-methyl-3-[(3Z,5Z)-5-methylhepta-3,5-dienyl]cyclohepta-1,3,5-triene.
| Compound Name | acetylene;ethane;7-methyl-3-[(3Z,5Z)-5-methylhepta-3,5-dienyl]cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 142246043 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | acetylene;ethane;7-methyl-3-[(3Z,5Z)-5-methylhepta-3,5-dienyl]cyclohepta-1,3,5-triene |
| SMILES | C#C.C/C=C(C)\C=C/CCC1=CC=CC(C)C=C1.CC |
| InChI | InChI=1S/C16H22.C2H6.C2H2/c1-4-14(2)8-5-6-10-16-11-7-9-15(3)12-13-16;2*1-2/h4-5,7-9,11-13,15H,6,10H2,1-3H3;1-2H3;1-2H/b8-5-,14-4-;; |
| InChIKey | AOHUSDKVCQPFDF-WYYVUSPRSA-N |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|