C19H26O4 — CID 123366139
2-[7-[4-(oxiran-2-ylmethoxy)cyclohexa-1,5-dien-1-yl]hepta-2,4-dien-3-yloxymethyl]oxirane (PubChem CID 123366139) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is 2-[7-[4-(oxiran-2-ylmethoxy)cyclohexa-1,5-dien-1-yl]hepta-2,4-dien-3-yloxymethyl]oxirane.
| Compound Name | 2-[7-[4-(oxiran-2-ylmethoxy)cyclohexa-1,5-dien-1-yl]hepta-2,4-dien-3-yloxymethyl]oxirane |
|---|---|
| PubChem CID | 123366139 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2-[7-[4-(oxiran-2-ylmethoxy)cyclohexa-1,5-dien-1-yl]hepta-2,4-dien-3-yloxymethyl]oxirane |
| SMILES | CC=C(C=CCCC1=CCC(OCC2CO2)C=C1)OCC1CO1 |
| InChI | InChI=1S/C19H26O4/c1-2-16(20-11-18-13-22-18)6-4-3-5-15-7-9-17(10-8-15)21-12-19-14-23-19/h2,4,6-9,17-19H,3,5,10-14H2,1H3 |
| InChIKey | SKERWXXUGYQCDR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|