C21H32O4 — CID 87159679
2-[[4-[2-[4-(oxiran-2-ylmethoxy)cyclohexen-1-yl]propan-2-yl]cyclohex-3-en-1-yl]oxymethyl]oxirane (PubChem CID 87159679) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is 2-[[4-[2-[4-(oxiran-2-ylmethoxy)cyclohexen-1-yl]propan-2-yl]cyclohex-3-en-1-yl]oxymethyl]oxirane.
| Compound Name | 2-[[4-[2-[4-(oxiran-2-ylmethoxy)cyclohexen-1-yl]propan-2-yl]cyclohex-3-en-1-yl]oxymethyl]oxirane |
|---|---|
| PubChem CID | 87159679 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 2-[[4-[2-[4-(oxiran-2-ylmethoxy)cyclohexen-1-yl]propan-2-yl]cyclohex-3-en-1-yl]oxymethyl]oxirane |
| SMILES | CC(C)(C1=CCC(OCC2CO2)CC1)C1=CCC(OCC2CO2)CC1 |
| InChI | InChI=1S/C21H32O4/c1-21(2,15-3-7-17(8-4-15)22-11-19-13-24-19)16-5-9-18(10-6-16)23-12-20-14-25-20/h3,5,17-20H,4,6-14H2,1-2H3 |
| InChIKey | JGTKBHOWGOZOCS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|