C11H19NO2 — CID 124554723
(1S,5S)-8-methyl-3-[[(2R)-oxiran-2-yl]methoxy]-8-azabicyclo[3.2.1]octane (PubChem CID 124554723) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (1S,5S)-8-methyl-3-[[(2R)-oxiran-2-yl]methoxy]-8-azabicyclo[3.2.1]octane.
| Compound Name | (1S,5S)-8-methyl-3-[[(2R)-oxiran-2-yl]methoxy]-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 124554723 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (1S,5S)-8-methyl-3-[[(2R)-oxiran-2-yl]methoxy]-8-azabicyclo[3.2.1]octane |
| SMILES | CN1[C@H]2CC[C@H]1CC(OC[C@H]1CO1)C2 |
| InChI | InChI=1S/C11H19NO2/c1-12-8-2-3-9(12)5-10(4-8)13-6-11-7-14-11/h8-11H,2-7H2,1H3/t8-,9-,11-/m0/s1 |
| InChIKey | FCNOKGVSFUNMSU-QXEWZRGKSA-N |
| XLogP | 1.03 |
| TPSA | 25.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|