C13H20O2 — CID 58519968
2-(4-tricyclo[5.2.1.02,6]decanyloxymethyl)oxirane (PubChem CID 58519968) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-(4-tricyclo[5.2.1.02,6]decanyloxymethyl)oxirane.
| Compound Name | 2-(4-tricyclo[5.2.1.02,6]decanyloxymethyl)oxirane |
|---|---|
| PubChem CID | 58519968 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 2-(4-tricyclo[5.2.1.02,6]decanyloxymethyl)oxirane |
| SMILES | C1OC1COC1CC2C3CCC(C3)C2C1 |
| InChI | InChI=1S/C13H20O2/c1-2-9-3-8(1)12-4-10(5-13(9)12)14-6-11-7-15-11/h8-13H,1-7H2 |
| InChIKey | KNSYYKUHEAELBL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|