C16H18O4 — CID 88664187
3-(oxiran-2-ylmethoxy)-3,4,7,8,9,10-hexahydrobenzo[c]chromen-6-one (PubChem CID 88664187) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-(oxiran-2-ylmethoxy)-3,4,7,8,9,10-hexahydrobenzo[c]chromen-6-one.
| Compound Name | 3-(oxiran-2-ylmethoxy)-3,4,7,8,9,10-hexahydrobenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 88664187 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 3-(oxiran-2-ylmethoxy)-3,4,7,8,9,10-hexahydrobenzo[c]chromen-6-one |
| SMILES | O=c1oc2c(c3c1CCCC3)C=CC(OCC1CO1)C2 |
| InChI | InChI=1S/C16H18O4/c17-16-14-4-2-1-3-12(14)13-6-5-10(7-15(13)20-16)18-8-11-9-19-11/h5-6,10-11H,1-4,7-9H2 |
| InChIKey | FFQFTBRUOXLNEK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 51.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|