C12H16ClN — CID 138546636
4-(5-chlorocyclohepta-1,3,6-trien-1-yl)-N-methylbutan-2-imine (PubChem CID 138546636) has the molecular formula C12H16ClN and a molecular weight of 209.72 g/mol. Its IUPAC name is 4-(5-chlorocyclohepta-1,3,6-trien-1-yl)-N-methylbutan-2-imine.
| Compound Name | 4-(5-chlorocyclohepta-1,3,6-trien-1-yl)-N-methylbutan-2-imine |
|---|---|
| PubChem CID | 138546636 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 4-(5-chlorocyclohepta-1,3,6-trien-1-yl)-N-methylbutan-2-imine |
| SMILES | C/N=C(\C)CCC1=CC=CC(Cl)C=C1 |
| InChI | InChI=1S/C12H16ClN/c1-10(14-2)6-7-11-4-3-5-12(13)9-8-11/h3-5,8-9,12H,6-7H2,1-2H3/b14-10+ |
| InChIKey | LLUNUJPQXNEJBU-GXDHUFHOSA-N |
| XLogP | 3.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|