About [4-(hydroxymethyl)cyclohepta-2,4,6-trien-1-yl]methanol
[4-(hydroxymethyl)cyclohepta-2,4,6-trien-1-yl]methanol (PubChem CID 144663501) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is [4-(hydroxymethyl)cyclohepta-2,4,6-trien-1-yl]methanol.
Analyze [4-(hydroxymethyl)cyclohepta-2,4,6-trien-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(hydroxymethyl)cyclohepta-2,4,6-trien-1-yl]methanol?
The IUPAC name of [4-(hydroxymethyl)cyclohepta-2,4,6-trien-1-yl]methanol (CID 144663501) is [4-(hydroxymethyl)cyclohepta-2,4,6-trien-1-yl]methanol.
What is the SMILES notation for [4-(hydroxymethyl)cyclohepta-2,4,6-trien-1-yl]methanol?
The canonical SMILES for [4-(hydroxymethyl)cyclohepta-2,4,6-trien-1-yl]methanol is OCC1=CC=CC(CO)C=C1.
What is the InChIKey of [4-(hydroxymethyl)cyclohepta-2,4,6-trien-1-yl]methanol?
The InChIKey is QOGNXYHAGUIJLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c10-6-8-2-1-3-9(7-11)5-4-8/h1-5,8,10-11H,6-7H2.
What are the key properties of [4-(hydroxymethyl)cyclohepta-2,4,6-trien-1-yl]methanol?
[4-(hydroxymethyl)cyclohepta-2,4,6-trien-1-yl]methanol has a molecular weight of 152.19 g/mol, XLogP of 0.64, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(hydroxymethyl)cyclohepta-2,4,6-trien-1-yl]methanol is sourced from PubChem (CID 144663501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).