C10H10S — CID 164589440
(5-ethynylcyclohepta-1,3,6-trien-1-yl)methanethiol (PubChem CID 164589440) has the molecular formula C10H10S and a molecular weight of 162.26 g/mol. Its IUPAC name is (5-ethynylcyclohepta-1,3,6-trien-1-yl)methanethiol.
| Compound Name | (5-ethynylcyclohepta-1,3,6-trien-1-yl)methanethiol |
|---|---|
| PubChem CID | 164589440 |
| Molecular Formula | C10H10S |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | (5-ethynylcyclohepta-1,3,6-trien-1-yl)methanethiol |
| SMILES | C#CC1C=CC=C(CS)C=C1 |
| InChI | InChI=1S/C10H10S/c1-2-9-4-3-5-10(8-11)7-6-9/h1,3-7,9,11H,8H2 |
| InChIKey | YQNQBJLZMGQFIJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|