About 2-amino-2-methyl-3-[4-(sulfanylmethyl)cyclohexa-2,4-dien-1-yl]propanoic acid
2-amino-2-methyl-3-[4-(sulfanylmethyl)cyclohexa-2,4-dien-1-yl]propanoic acid (PubChem CID 123849357) has the molecular formula C11H17NO2S
and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-amino-2-methyl-3-[4-(sulfanylmethyl)cyclohexa-2,4-dien-1-yl]propanoic acid.
Molecular Properties
| Compound Name | 2-amino-2-methyl-3-[4-(sulfanylmethyl)cyclohexa-2,4-dien-1-yl]propanoic acid |
| PubChem CID | 123849357 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 2-amino-2-methyl-3-[4-(sulfanylmethyl)cyclohexa-2,4-dien-1-yl]propanoic acid |
| SMILES | CC(N)(CC1C=CC(CS)=CC1)C(=O)O |
| InChI | InChI=1S/C11H17NO2S/c1-11(12,10(13)14)6-8-2-4-9(7-15)5-3-8/h2,4-5,8,15H,3,6-7,12H2,1H3,(H,13,14) |
| InChIKey | NGRAQJRVGKWTMQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-methyl-3-[4-(sulfanylmethyl)cyclohexa-2,4-dien-1-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-methyl-3-[4-(sulfanylmethyl)cyclohexa-2,4-dien-1-yl]propanoic acid?
The IUPAC name of 2-amino-2-methyl-3-[4-(sulfanylmethyl)cyclohexa-2,4-dien-1-yl]propanoic acid (CID 123849357) is 2-amino-2-methyl-3-[4-(sulfanylmethyl)cyclohexa-2,4-dien-1-yl]propanoic acid.
What is the SMILES notation for 2-amino-2-methyl-3-[4-(sulfanylmethyl)cyclohexa-2,4-dien-1-yl]propanoic acid?
The canonical SMILES for 2-amino-2-methyl-3-[4-(sulfanylmethyl)cyclohexa-2,4-dien-1-yl]propanoic acid is CC(N)(CC1C=CC(CS)=CC1)C(=O)O.
What is the InChIKey of 2-amino-2-methyl-3-[4-(sulfanylmethyl)cyclohexa-2,4-dien-1-yl]propanoic acid?
The InChIKey is NGRAQJRVGKWTMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2S/c1-11(12,10(13)14)6-8-2-4-9(7-15)5-3-8/h2,4-5,8,15H,3,6-7,12H2,1H3,(H,13,14).
What are the key properties of 2-amino-2-methyl-3-[4-(sulfanylmethyl)cyclohexa-2,4-dien-1-yl]propanoic acid?
2-amino-2-methyl-3-[4-(sulfanylmethyl)cyclohexa-2,4-dien-1-yl]propanoic acid has a molecular weight of 227.33 g/mol, XLogP of 1.61, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-methyl-3-[4-(sulfanylmethyl)cyclohexa-2,4-dien-1-yl]propanoic acid is sourced from PubChem (CID 123849357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).