C10H14O2S — CID 89228535
[(3aR,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]methanethiol (PubChem CID 89228535) has the molecular formula C10H14O2S and a molecular weight of 198.29 g/mol. Its IUPAC name is [(3aR,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]methanethiol.
| Compound Name | [(3aR,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]methanethiol |
|---|---|
| PubChem CID | 89228535 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | [(3aR,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]methanethiol |
| SMILES | CC1(C)O[C@H]2C=CC=C(CS)[C@H]2O1 |
| InChI | InChI=1S/C10H14O2S/c1-10(2)11-8-5-3-4-7(6-13)9(8)12-10/h3-5,8-9,13H,6H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | CPJJUFRSYFWGKA-DTWKUNHWSA-N |
| XLogP | 1.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|