C9H11BO2 — CID 88564779
CID 88564779 (PubChem CID 88564779) has the molecular formula C9H11BO2 and a molecular weight of 162.00 g/mol.
| Compound Name | CID 88564779 |
|---|---|
| PubChem CID | 88564779 |
| Molecular Formula | C9H11BO2 |
| Molecular Weight | 162.00 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | — |
| SMILES | [B]C1=CC=CC2OC(C)(C)OC12 |
| InChI | InChI=1S/C9H11BO2/c1-9(2)11-7-5-3-4-6(10)8(7)12-9/h3-5,7-8H,1-2H3 |
| InChIKey | ZXOJNCWUMZSZIO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.00 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|