C19H24O — CID 142415352
acetylene;1-cyclobutyl-4-[(2Z,4Z)-4-methylhexa-2,4-dienoxy]benzene (PubChem CID 142415352) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is acetylene;1-cyclobutyl-4-[(2Z,4Z)-4-methylhexa-2,4-dienoxy]benzene.
| Compound Name | acetylene;1-cyclobutyl-4-[(2Z,4Z)-4-methylhexa-2,4-dienoxy]benzene |
|---|---|
| PubChem CID | 142415352 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | acetylene;1-cyclobutyl-4-[(2Z,4Z)-4-methylhexa-2,4-dienoxy]benzene |
| SMILES | C#C.C/C=C(C)\C=C/COc1ccc(C2CCC2)cc1 |
| InChI | InChI=1S/C17H22O.C2H2/c1-3-14(2)6-5-13-18-17-11-9-16(10-12-17)15-7-4-8-15;1-2/h3,5-6,9-12,15H,4,7-8,13H2,1-2H3;1-2H/b6-5-,14-3-; |
| InChIKey | UHISAANKPIWBDD-CHNKTMFPSA-N |
| XLogP | 5.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|