C29H33F3O — CID 143772585
(3Z,7Z,11E,14E)-3,4,12-trifluoro-14,17-dimethyl-5,6,9,10,13-pentamethylidene-2-prop-2-enoxynonadeca-1,3,7,11,14,18-hexaene (PubChem CID 143772585) has the molecular formula C29H33F3O and a molecular weight of 454.58 g/mol. Its IUPAC name is (3Z,7Z,11E,14E)-3,4,12-trifluoro-14,17-dimethyl-5,6,9,10,13-pentamethylidene-2-prop-2-enoxynonadeca-1,3,7,11,14,18-hexaene.
| Compound Name | (3Z,7Z,11E,14E)-3,4,12-trifluoro-14,17-dimethyl-5,6,9,10,13-pentamethylidene-2-prop-2-enoxynonadeca-1,3,7,11,14,18-hexaene |
|---|---|
| PubChem CID | 143772585 |
| Molecular Formula | C29H33F3O |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | (3Z,7Z,11E,14E)-3,4,12-trifluoro-14,17-dimethyl-5,6,9,10,13-pentamethylidene-2-prop-2-enoxynonadeca-1,3,7,11,14,18-hexaene |
| SMILES | C=CCOC(=C)/C(F)=C(\F)C(=C)C(=C)/C=C/C(=C)C(=C)/C=C(\F)C(=C)/C(C)=C/CC(C)C=C |
| InChI | InChI=1S/C29H33F3O/c1-11-17-33-26(10)29(32)28(31)25(9)22(6)16-15-20(4)23(7)18-27(30)24(8)21(5)14-13-19(3)12-2/h11-12,14-16,18-19H,1-2,4,6-10,13,17H2,3,5H3/b16-15-,21-14+,27-18+,29-28- |
| InChIKey | YMKNVBLETWCDEU-PNXDPHLMSA-N |
| XLogP | 9.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|