C26H37FO3 — CID 145122181
(3E,7E,11Z)-7-fluoro-2-methoxy-4-(methoxymethyl)-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraene;prop-2-enal (PubChem CID 145122181) has the molecular formula C26H37FO3 and a molecular weight of 416.58 g/mol. Its IUPAC name is (3E,7E,11Z)-7-fluoro-2-methoxy-4-(methoxymethyl)-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraene;prop-2-enal.
| Compound Name | (3E,7E,11Z)-7-fluoro-2-methoxy-4-(methoxymethyl)-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraene;prop-2-enal |
|---|---|
| PubChem CID | 145122181 |
| Molecular Formula | C26H37FO3 |
| Molecular Weight | 416.58 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | (3E,7E,11Z)-7-fluoro-2-methoxy-4-(methoxymethyl)-10,13-dimethyl-5,6,9-trimethylidenepentadeca-1,3,7,11-tetraene;prop-2-enal |
| SMILES | C=C(/C=C(/COC)C(=C)C(=C)/C(F)=C\C(=C)C(C)/C=C\C(C)CC)OC.C=CC=O |
| InChI | InChI=1S/C23H33FO2.C3H4O/c1-10-16(2)11-12-17(3)18(4)13-23(24)21(7)20(6)22(15-25-8)14-19(5)26-9;1-2-3-4/h11-14,16-17H,4-7,10,15H2,1-3,8-9H3;2-3H,1H2/b12-11-,22-14-,23-13+; |
| InChIKey | IKTFCLJLWWLLCH-VMQXXKNJSA-N |
| XLogP | 6.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.58 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|