C28H46O3 — CID 145122327
ethane;(3Z,7Z)-2-methoxy-7-(2-methoxyethyl)-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene;prop-2-enal (PubChem CID 145122327) has the molecular formula C28H46O3 and a molecular weight of 430.67 g/mol. Its IUPAC name is ethane;(3Z,7Z)-2-methoxy-7-(2-methoxyethyl)-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene;prop-2-enal.
| Compound Name | ethane;(3Z,7Z)-2-methoxy-7-(2-methoxyethyl)-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene;prop-2-enal |
|---|---|
| PubChem CID | 145122327 |
| Molecular Formula | C28H46O3 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.34 |
| IUPAC Name | ethane;(3Z,7Z)-2-methoxy-7-(2-methoxyethyl)-10,13-dimethyl-5,6,9-trimethylidenetetradeca-1,3,7-triene;prop-2-enal |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(=C\C(=C)C(C)CCC(C)C)CCOC)OC.C=CC=O.CC |
| InChI | InChI=1S/C23H36O2.C3H4O.C2H6/c1-17(2)10-11-18(3)20(5)16-23(14-15-24-8)22(7)19(4)12-13-21(6)25-9;1-2-3-4;1-2/h12-13,16-18H,4-7,10-11,14-15H2,1-3,8-9H3;2-3H,1H2;1-2H3/b13-12-,23-16-;; |
| InChIKey | CWFYCGJPFYJFPL-BGWNIYMDSA-N |
| XLogP | 7.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|